Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2,5-Dimethoxy-4-methylphenylcyclopropylamine: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 408393026 of page 4-Methyl-2,5-methoxyphenylcyclopropylamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5 |
||
| Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:4-Methyl-2,5-methoxyphenylcyclopropylamine|oldid=408393026}} 408393026] of page [[4-Methyl-2,5-methoxyphenylcyclopropylamine]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 477222551 |
||
| ImageFile1 = DMCPA. |
| ImageFile1 = DMCPA.svg |
||
| ImageSize1 = 200px |
| ImageSize1 = 200px |
||
| ImageFile2 = DMCPA-3d-sticks.png |
| ImageFile2 = DMCPA-3d-sticks.png |
||
| ImageSize2 = 200px |
| ImageSize2 = 200px |
||
| |
| PIN = 2-(2,5-Dimethoxy-4-methylphenyl)cyclopropan-1-amine |
||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 2285590 |
| ChemSpiderID = 2285590 |
||
| Line 19: | Line 19: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = HYVPPECPQRBJEQ-UHFFFAOYSA-N |
| StdInChIKey = HYVPPECPQRBJEQ-UHFFFAOYSA-N |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CASNo = <!-- blanked - oldvalue: 69854-49-5 --> |
|||
| CASNo = 714903-64-7 |
|||
| CASNo1_Ref = {{cascite|correct|CAS}} |
|||
| CASNo1 = 69854-49-5 |
|||
| CASNo1_Comment = (non-specific) |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = U2YC8RFK7B |
|||
| PubChem = 3017965 |
| PubChem = 3017965 |
||
| SMILES = O(c1c(cc(OC)c(c1)C2CC2N)C)C |
| SMILES = O(c1c(cc(OC)c(c1)C2CC2N)C)C |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=12 |
|||
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>2</sub> |
|||
| H=17 |
|||
| MolarMass = 207.27 g/mol |
|||
| N=1 |
|||
| O=2 |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| Line 31: | Line 39: | ||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
'''2,5-Dimethoxy-4-methylphenylcyclopropylamine''' ('''DMCPA''') is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]] and a [[substituted amphetamine]]. DMCPA was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', the dosage range is listed as 15–20 mg and the duration is listed as 4–8 hours.<ref>[http://www.erowid.org/library/books_online/pihkal/pihkal056.shtml DMCPA Entry in ''PiHKAL'']</ref> DMCPA produces open-eye visuals, [[Anorexia (symptom)|anorexia]], and [[psychedelic experience|psychedelic]] [[dreams]]. Shulgin gives it a +++ on the [[Shulgin Rating Scale]]. |
|||
==Legality== |
|||
===United Kingdom=== |
|||
This substance is a Class A drug in the [[Drugs controlled by the UK Misuse of Drugs Act#Class A drugs|Drugs controlled by the UK Misuse of Drugs Act]].<ref>{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | access-date = 12 March 2014 | publisher = Isomer Design | archive-date = 22 October 2017 | archive-url = https://web.archive.org/web/20171022085110/http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | url-status = dead }}</ref> |
|||
==Pharmacology== |
|||
Very little data exists about the pharmacological properties, metabolism, and toxicity of DMCPA. |
|||
== See also == |
|||
* [[Phenethylamine]] |
|||
* [[Psychedelics, dissociatives and deliriants]] |
|||
* [[Tranylcypromine]] |
|||
== References== |
|||
{{reflist}} |
|||
{{Hallucinogens}} |
|||
{{Phenethylamines}} |
|||
{{DEFAULTSORT:Dimethoxy-4-methylphenylcyclopropylamine, 2,5-}} |
|||
[[Category:Psychedelic phenethylamines]] |
|||
[[Category:Cyclopropanes]] |
|||