Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Methorphan: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456779102 of page Methorphan for the Chem/Drugbox validation project (updated: 'CAS_number').
 
Add "distinguish" based on redirect "racemethorphan"
Tags: Mobile edit Mobile web edit Advanced mobile edit
 
Line 1: Line 1:
{{Short description|Group of stereoisomers}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Methorphan|oldid=456779102}} 456779102] of page [[Methorphan]] with values updated to verified values.}}
{{Distinguish|racemorphan}}
{{Drugbox
{{Drugbox
| drug_name = Racemethorphan
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 408592791
| verifiedrevid = 462249979
| IUPAC_name = 3-methoxy-17-methylmorphinan
| IUPAC_name = 3-Methoxy-17-methylmorphinan
| imageL = Levomethorphan.svg
| altL =
| imageR = Dextromethorphan.svg
| widthR =
| altR =
| captionLR = Levomethorphan (L), dextromethorphan (R)


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_category =
| pregnancy_category =
| legal_status =
| legal_status =
| legal_AU = S9
| routes_of_administration =
| legal_BR = A1
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref>
| legal_CA = Schedule I
| legal_DE = Anlage I
| legal_UK = Class A
| legal_UN = P I
| legal_US = Schedule II
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| ATC_prefix = None
| CAS_number_Ref = {{cascite|correct|??}}
| ATC_suffix =
| CAS_number = <!-- blanked - oldvalue: 6031-86-3 -->
| ATC_prefix =
| PubChem = 3008
| CAS_number_Ref = {{cascite|changed|??}}
| ATC_suffix =
| PubChem =
| CAS_number = 510-53-2
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 16736909
| ChemSpiderID = 2901
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8YB8F78WM1
| UNII = 8YB8F78WM1
| ChEBI = 146177
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 282713
| ChEMBL = 22207


<!--Chemical data-->
<!--Chemical data-->
| C=18 | H=25 | N=1 | O=1
| chemical_formula = C<sub>18</sub>H<sub>25</sub>NO
| molecular_weight =
| smiles = CN1CCC23CCCCC2C1CC4=C3C=C(C=C4)OC
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MKXZASYAUGDDCJ-UHFFFAOYSA-N
}}


'''Methorphan''' comes in two [[isomeric]] [[drug form|form]]s, each with differing [[pharmacology]] and [[therapeutic effect|effect]]s:
| molecular_weight = 271.40 g/mol

| smiles = COc2ccc3C[C@@H]1C4CCCC[C@]4(CCN1C)c3c2
* [[Dextromethorphan]]{{snd}} An [[Over-the-counter drug|over-the-counter]] [[cough suppressant]], as well as [[dissociative drug|dissociative]] [[hallucinogen]].
| InChI = 1/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15?,17-,18-/m1/s1
* [[Levomethorphan]]{{snd}} A [[potent (pharmacology)|potent]] [[opioid]] [[analgesic]] that was never [[clinic]]ally [[drug development|developed]]; a [[prodrug]] of the powerful opioid agonist analgesic [[levorphanol]] (Levo-Dromoran).
| InChIKey = MKXZASYAUGDDCJ-HSFDIDPMBE

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
'''Racemethorphan''' is the [[racemic mixture]] of both of these [[stereoisomers]].<ref name="Aumatell_1993">{{cite journal | vauthors = Aumatell A, Wells RJ | title = Chiral differentiation of the optical isomers of racemethorphan and racemorphan in urine by capillary zone electrophoresis | journal = Journal of Chromatographic Science | volume = 31 | issue = 12 | pages = 502–8 | date = December 1993 | pmid = 8120122 | doi = 10.1093/chromsci/31.12.502 }}</ref> It is listed under the Single Convention on Narcotic Drugs 1961 and is therefore listed in the United States as a Controlled Substance, specifically as a Narcotic in Schedule II with an ACSCN of 9732 and an annual aggregate manufacturing quota of 3 grams in 2014.<ref>{{cite web|url=http://www.deadiversion.usdoj.gov/quotas/conv_factor/index.html|title=Conversion Factors for Controlled Substances|website=www.deadiversion.usdoj.gov}}</ref><ref>{{cite book | vauthors = Nordegren T | chapter = Racemethorphan | chapter-url = https://books.google.com/books?id=4yaGePenGKgC&pg=PA549 |title=The A-Z Encyclopedia of Alcohol and Drug Abuse |date=2002 |publisher=Brown Walker Press |location=Parkland, Fla. |isbn=978-1-58112-404-0 |pages=548–549 }}</ref> The salts in use are the hydrobromide (free base conversion ratio 0.770) and the tartrate (0.644).
| StdInChI = 1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15?,17-,18-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
== See also ==
| StdInChIKey = MKXZASYAUGDDCJ-HSFDIDPMSA-N
* [[Morphinan]]
* [[Racemorphan]]

== References ==
{{Reflist}}


{{Hallucinogens}}
{{Navboxes
| title = [[Pharmacodynamics]]
| titlestyle = background:#ccccff
| list1 =
{{Glycine receptor modulators}}
{{Ionotropic glutamate receptor modulators}}
{{Monoamine reuptake inhibitors}}
{{Nicotinic acetylcholine receptor modulators}}
{{Opioid receptor modulators}}
}}
}}

[[Category:Morphinans]]
[[Category:Phenol ethers]]
[[Category:Synthetic opioids]]
[[Category:Dissociative drugs]]


{{nervous-system-drug-stub}}
{{respiratory-system-drug-stub}}