Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Methorphan: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456779102 of page Methorphan for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Add "distinguish" based on redirect "racemethorphan" Tags: Mobile edit Mobile web edit Advanced mobile edit |
||
Line 1: | Line 1: | ||
{{Short description|Group of stereoisomers}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Methorphan|oldid=456779102}} 456779102] of page [[Methorphan]] with values updated to verified values.}} |
|||
{{Distinguish|racemorphan}} |
|||
{{Drugbox |
{{Drugbox |
||
| drug_name = Racemethorphan |
|||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 462249979 |
||
| IUPAC_name = 3- |
| IUPAC_name = 3-Methoxy-17-methylmorphinan |
||
| imageL = Levomethorphan.svg |
|||
| altL = |
|||
| imageR = Dextromethorphan.svg |
|||
| widthR = |
|||
| altR = |
|||
| captionLR = Levomethorphan (L), dextromethorphan (R) |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_status = |
| legal_status = |
||
| legal_AU = S9 |
|||
⚫ | |||
| legal_BR = A1 |
|||
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|||
| legal_CA = Schedule I |
|||
| legal_DE = Anlage I |
|||
| legal_UK = Class A |
|||
| legal_UN = P I |
|||
| legal_US = Schedule II |
|||
⚫ | |||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| ATC_prefix = None |
|||
⚫ | |||
⚫ | |||
| CAS_number = <!-- blanked - oldvalue: 6031-86-3 --> |
|||
| |
| PubChem = 3008 |
||
⚫ | |||
⚫ | |||
| |
| CAS_number = 510-53-2 |
||
| ChemSpiderID_Ref = {{chemspidercite| |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
||
| ChemSpiderID = |
| ChemSpiderID = 2901 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 8YB8F78WM1 |
| UNII = 8YB8F78WM1 |
||
| ChEBI = 146177 |
|||
| ChEMBL_Ref = {{ebicite| |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 22207 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=18 | H=25 | N=1 | O=1 |
|||
| chemical_formula = C<sub>18</sub>H<sub>25</sub>NO |
|||
⚫ | |||
| smiles = CN1CCC23CCCCC2C1CC4=C3C=C(C=C4)OC |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
|||
'''Methorphan''' comes in two [[isomeric]] [[drug form|form]]s, each with differing [[pharmacology]] and [[therapeutic effect|effect]]s: |
|||
⚫ | |||
| smiles = COc2ccc3C[C@@H]1C4CCCC[C@]4(CCN1C)c3c2 |
|||
* [[Dextromethorphan]]{{snd}} An [[Over-the-counter drug|over-the-counter]] [[cough suppressant]], as well as [[dissociative drug|dissociative]] [[hallucinogen]]. |
|||
| InChI = 1/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15?,17-,18-/m1/s1 |
|||
* [[Levomethorphan]]{{snd}} A [[potent (pharmacology)|potent]] [[opioid]] [[analgesic]] that was never [[clinic]]ally [[drug development|developed]]; a [[prodrug]] of the powerful opioid agonist analgesic [[levorphanol]] (Levo-Dromoran). |
|||
| InChIKey = MKXZASYAUGDDCJ-HSFDIDPMBE |
|||
⚫ | |||
'''Racemethorphan''' is the [[racemic mixture]] of both of these [[stereoisomers]].<ref name="Aumatell_1993">{{cite journal | vauthors = Aumatell A, Wells RJ | title = Chiral differentiation of the optical isomers of racemethorphan and racemorphan in urine by capillary zone electrophoresis | journal = Journal of Chromatographic Science | volume = 31 | issue = 12 | pages = 502–8 | date = December 1993 | pmid = 8120122 | doi = 10.1093/chromsci/31.12.502 }}</ref> It is listed under the Single Convention on Narcotic Drugs 1961 and is therefore listed in the United States as a Controlled Substance, specifically as a Narcotic in Schedule II with an ACSCN of 9732 and an annual aggregate manufacturing quota of 3 grams in 2014.<ref>{{cite web|url=http://www.deadiversion.usdoj.gov/quotas/conv_factor/index.html|title=Conversion Factors for Controlled Substances|website=www.deadiversion.usdoj.gov}}</ref><ref>{{cite book | vauthors = Nordegren T | chapter = Racemethorphan | chapter-url = https://books.google.com/books?id=4yaGePenGKgC&pg=PA549 |title=The A-Z Encyclopedia of Alcohol and Drug Abuse |date=2002 |publisher=Brown Walker Press |location=Parkland, Fla. |isbn=978-1-58112-404-0 |pages=548–549 }}</ref> The salts in use are the hydrobromide (free base conversion ratio 0.770) and the tartrate (0.644). |
|||
⚫ | |||
⚫ | |||
== See also == |
|||
⚫ | |||
* [[Morphinan]] |
|||
* [[Racemorphan]] |
|||
== References == |
|||
{{Reflist}} |
|||
{{Hallucinogens}} |
|||
{{Navboxes |
|||
| title = [[Pharmacodynamics]] |
|||
| titlestyle = background:#ccccff |
|||
| list1 = |
|||
{{Glycine receptor modulators}} |
|||
{{Ionotropic glutamate receptor modulators}} |
|||
{{Monoamine reuptake inhibitors}} |
|||
{{Nicotinic acetylcholine receptor modulators}} |
|||
{{Opioid receptor modulators}} |
|||
}} |
}} |
||
[[Category:Morphinans]] |
|||
[[Category:Phenol ethers]] |
|||
[[Category:Synthetic opioids]] |
|||
[[Category:Dissociative drugs]] |
|||
{{nervous-system-drug-stub}} |
|||
{{respiratory-system-drug-stub}} |