Jump to content

SB-204741: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
PotatoBot (talk | contribs)
Bots
51,239 edits
m Stub sorting and placement of stub template(s): nervous-system-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.
Importing Wikidata short description: "Chemical compound"
 
(19 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| verifiedrevid = 407718743
| verifiedrevid = 449586687
| IUPAC_name = ''N''-(1-Methyl-1''H''-indol-5-yl)-''N'''-(3-methylisothiazol-5-yl)urea
| IUPAC_name = ''N''-(1-Methyl-1''H''-indol-5-yl)-''N'''-(3-methylisothiazol-5-yl)urea
| image = SB-204,741_structure.png
| image = SB-204,741_structure.png
Line 25: Line 26:


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 152239-46-8
| CAS_number = 152239-46-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9VHM49MS42
| ATC_prefix =
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
| PubChem = 3277600
| PubChem = 3277600
| ChEBI = 140936
| IUPHAR_ligand = 221
| IUPHAR_ligand = 221
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| ChemSpiderID = 2526822


<!--Chemical data-->
<!--Chemical data-->
| C=14 | H=14 | N=4 | O=1 | S=1
| C=14 | H=14 | N=4 | O=1 | S=1
| molecular_weight = 286.352 g/mol
| smiles = c2c(C)nsc2NC(=O)Nc3ccc1n(C)ccc1c3
| smiles = c2c(C)nsc2NC(=O)Nc3ccc1n(C)ccc1c3
| synonyms = SB-204,741
| synonyms = SB-204,741
| StdInChI = 1S/C14H14N4OS/c1-9-7-13(20-17-9)16-14(19)15-11-3-4-12-10(8-11)5-6-18(12)2/h3-8H,1-2H3,(H2,15,16,19)
| StdInChIKey = USFUFHFQWXDVMH-UHFFFAOYSA-N
}}
}}


'''SB-204,741''' is a drug which acts as a potent and selective [[Antagonist (pharmacology)|antagonist]] at the [[serotonin]] [[5-HT2B receptor|5-HT<sub>2B</sub>]] [[Receptor (biochemistry)|receptor]], with around 135x selectivity over the closely related [[5-HT2C receptor|5-HT<sub>2C</sub>]] receptor, and even higher over the [[5-HT2A receptor|5-HT<sub>2A</sub>]] receptor and other targets.<ref>{{cite journal | last1 = Forbes | first1 = IT | last2 = Jones | first2 = GE | last3 = Murphy | first3 = OE | last4 = Holland | first4 = V | last5 = Baxter | first5 = GS | title = N-(1-methyl-5-indolyl)-N'-(3-methyl-5-isothiazolyl)urea: a novel, high-affinity 5-HT2B receptor antagonist | journal = Journal of medicinal chemistry | volume = 38 | issue = 6 | pages = 855–7 | year = 1995 | pmid = 7699699 }}</ref> It is used in scientific research for investigating the functions of the 5-HT<sub>2B</sub> receptor.<ref>{{cite journal | last1 = Glusa | first1 = E | last2 = Pertz | first2 = HH | title = Further evidence that 5-HT-induced relaxation of pig pulmonary artery is mediated by endothelial 5-HT(2B) receptors | journal = British journal of pharmacology | volume = 130 | issue = 3 | pages = 692–8 | year = 2000 | pmid = 10821800 | pmc = 1572101 | doi = 10.1038/sj.bjp.0703341 }}</ref><ref>{{cite journal | last1 = Holohean | first1 = AM | last2 = Hackman | first2 = JC | title = Mechanisms intrinsic to 5-HT2B receptor-induced potentiation of NMDA receptor responses in frog motoneurones | journal = British journal of pharmacology | volume = 143 | issue = 3 | pages = 351–60 | year = 2004 | pmid = 15339859 | pmc = 1575347 | doi = 10.1038/sj.bjp.0705935 }}</ref><ref>{{cite journal | last1 = Papageorgiou | first1 = A | last2 = Denef | first2 = C | title = Stimulation of growth hormone release by 5-hydroxytryptamine (5-HT) in cultured rat anterior pituitary cell aggregates: evidence for mediation by 5-HT2B, 5-HT7, 5-HT1B, and ketanserin-sensitive receptors | journal = Endocrinology | volume = 148 | issue = 9 | pages = 4509–22 | year = 2007 | pmid = 17584957 | doi = 10.1210/en.2007-0034 }}</ref><ref>{{cite journal | last1 = Wouters | first1 = MM | last2 = Gibbons | first2 = SJ | last3 = Roeder | first3 = JL | last4 = Distad | first4 = M | last5 = Ou | first5 = Y | last6 = Strege | first6 = PR | last7 = Szurszewski | first7 = JH | last8 = Farrugia | first8 = G | title = Exogenous serotonin regulates proliferation of interstitial cells of Cajal in mouse jejunum through 5-HT2B receptors | journal = Gastroenterology | volume = 133 | issue = 3 | pages = 897–906 | year = 2007 | pmid = 17854596 | doi = 10.1053/j.gastro.2007.06.017 }}</ref>
'''SB-204741''' is a drug which acts as a potent and selective [[Antagonist (pharmacology)|antagonist]] at the [[serotonin]] [[5-HT2B receptor|5-HT<sub>2B</sub>]] [[Receptor (biochemistry)|receptor]], with around 135x selectivity over the closely related [[5-HT2C receptor|5-HT<sub>2C</sub>]] receptor, and even higher over the [[5-HT2A receptor|5-HT<sub>2A</sub>]] receptor and other targets.<ref>{{cite journal | vauthors = Forbes IT, Jones GE, Murphy OE, Holland V, Baxter GS | title = N-(1-methyl-5-indolyl)-N'-(3-methyl-5-isothiazolyl)urea: a novel, high-affinity 5-HT2B receptor antagonist | journal = Journal of Medicinal Chemistry | volume = 38 | issue = 6 | pages = 855–7 | date = March 1995 | pmid = 7699699 | doi = 10.1021/jm00006a001 }}</ref> It is used in scientific research for investigating the functions of the 5-HT<sub>2B</sub> receptor.<ref>{{cite journal | vauthors = Glusa E, Pertz HH | title = Further evidence that 5-HT-induced relaxation of pig pulmonary artery is mediated by endothelial 5-HT(2B) receptors | journal = British Journal of Pharmacology | volume = 130 | issue = 3 | pages = 692–8 | date = June 2000 | pmid = 10821800 | pmc = 1572101 | doi = 10.1038/sj.bjp.0703341 }}</ref><ref>{{cite journal | vauthors = Holohean AM, Hackman JC | title = Mechanisms intrinsic to 5-HT2B receptor-induced potentiation of NMDA receptor responses in frog motoneurones | journal = British Journal of Pharmacology | volume = 143 | issue = 3 | pages = 351–60 | date = October 2004 | pmid = 15339859 | pmc = 1575347 | doi = 10.1038/sj.bjp.0705935 }}</ref><ref>{{cite journal | vauthors = Papageorgiou A, Denef C | title = Stimulation of growth hormone release by 5-hydroxytryptamine (5-HT) in cultured rat anterior pituitary cell aggregates: evidence for mediation by 5-HT2B, 5-HT7, 5-HT1B, and ketanserin-sensitive receptors | journal = Endocrinology | volume = 148 | issue = 9 | pages = 4509–22 | date = September 2007 | pmid = 17584957 | doi = 10.1210/en.2007-0034 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Wouters MM, Gibbons SJ, Roeder JL, Distad M, Ou Y, Strege PR, Szurszewski JH, Farrugia G | display-authors = 6 | title = Exogenous serotonin regulates proliferation of interstitial cells of Cajal in mouse jejunum through 5-HT2B receptors | journal = Gastroenterology | volume = 133 | issue = 3 | pages = 897–906 | date = September 2007 | pmid = 17854596 | doi = 10.1053/j.gastro.2007.06.017 | url = https://lirias.kuleuven.be/bitstream/123456789/160659/1/2007+Gastro+5-HT.pdf }}</ref>


== References ==
== References ==
{{reflist}}
{{Reflist|2}}


{{Serotonergics}}
{{Serotonergics}}
Line 51: Line 58:
[[Category:Ureas]]
[[Category:Ureas]]
[[Category:Indoles]]
[[Category:Indoles]]



{{nervous-system-drug-stub}}
{{nervous-system-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"