Bendazac: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'DrugBank_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
| (18 intermediate revisions by 14 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 447984244 |
||
| IUPAC_name = [(1-benzyl-1''H''-indazol-3-yl)oxy]acetic acid |
| IUPAC_name = [(1-benzyl-1''H''-indazol-3-yl)oxy]acetic acid |
||
| image = Bendazac.svg |
| image = Bendazac.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Line 17: | Line 18: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = Topical |
| routes_of_administration = Topical |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| Line 24: | Line 24: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 20187-55-7 |
| CAS_number = 20187-55-7 |
||
| ATC_prefix = M02 |
| ATC_prefix = M02 |
||
| ATC_suffix = AA11 |
| ATC_suffix = AA11 |
||
| ATC_supplemental = {{ATC|S01|BC07}} |
|||
| PubChem = 2313 |
| PubChem = 2313 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| Line 39: | Line 39: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D01594 |
| KEGG = D01594 |
||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 31257 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 1089221 |
| ChEMBL = 1089221 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=16 | H=14 |
| C=16 | H=14 |
||
| N=2 | O=3 |
|||
| molecular_weight = 282.294 g/mol |
|||
| smiles = O=C(O)COc2nn(c1ccccc12)Cc3ccccc3 |
| smiles = O=C(O)COc2nn(c1ccccc12)Cc3ccccc3 |
||
| InChI = 1/C16H14N2O3/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20) |
|||
| InChIKey = BYFMCKSPFYVMOU-UHFFFAOYAS |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C16H14N2O3/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20) |
| StdInChI = 1S/C16H14N2O3/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20) |
||
| Line 53: | Line 52: | ||
| StdInChIKey = BYFMCKSPFYVMOU-UHFFFAOYSA-N |
| StdInChIKey = BYFMCKSPFYVMOU-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Bendazac''' (or '''bendazolic acid''') is a [[non-steroidal anti-inflammatory drug]] used for joint and muscular pain. |
|||
'''Bendazac''' (or '''bendazolic acid''') is a [[nonsteroidal anti-inflammatory drug]] (NSAID) used for joint and muscular pain.<ref name="pmid2190795">{{cite journal | vauthors = Balfour JA, Clissold SP | title = Bendazac lysine. A review of its pharmacological properties and therapeutic potential in the management of cataracts | journal = Drugs | volume = 39 | issue = 4 | pages = 575–96 | date = April 1990 | pmid = 2190795 | doi = 10.2165/00003495-199039040-00007 | s2cid = 46956362 }}</ref> |
|||
==Synthesis== |
|||
Principal action is inhibition of protein denaturation. |
|||
[[File:Bendazac synthesis.svg|thumb|center|700px|Bendazac synthesis: {{Cite patent|country=BE|number=699226}}; G. Palazzo, {{US patent|3470194}} (1967, 1969 both to [[Francesco Angelini]]).]] |
|||
Use of [[chloroacetamide]] in the alkylation step, followed by acid hydrolysis produces bendazac (instead of [[benzydamine]]). |
|||
==See also== |
|||
* [[Benzydamine]] |
|||
==References== |
|||
{{Reflist}} |
|||
{{NSAIDs}} |
{{NSAIDs}} |
||
{{Topical products for joint and muscular pain}} |
{{Topical products for joint and muscular pain}} |
||
{{Prostanoidergics}} |
|||
[[Category: |
[[Category:Hepatotoxins]] |
||
[[Category:Nonsteroidal anti-inflammatory drugs]] |
|||